RefMet Compound Details
| RefMet ID, RefMet name, exact mass and formula | ||
| RefMet ID | RM0108948 | |
|---|---|---|
| RefMet name | Profenofos | |
| Systematic name | O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate | |
| Synonyms | PubChem Synonyms | |
| Exact mass | 371.935142 (neutral) | |
| RefMet ID, RefMet name, exact mass and formula | ||
| RefMet ID | RM0108948 | |
|---|---|---|
| RefMet name | Profenofos | |
| Systematic name | O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate | |
| Synonyms | PubChem Synonyms | |
| Exact mass | 371.935142 (neutral) | |
|