RefMet Compound Details
MW structure | 37865 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | S-Formylglutathione | |
Systematic name | (2S)-2-amino-4-{[(1R)-1-[(carboxymethyl)carbamoyl]-2-(formylsulfanyl)ethyl]carbamoyl}butanoic acid | |
SMILES | C(CC(=O)N[C@@H](CSC=O)C(=O)NCC(=O)O)[C@@H](C(=O)O)N Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 335.078721 (neutral) |
Table of KEGG reactions in human pathways involving S-Formylglutathione
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00527 | S-Formylglutathione + H2O <=> Formate + Glutathione | S-Formylglutathione hydrolase |
R06983 | S-(Hydroxymethyl)glutathione + NAD+ <=> S-Formylglutathione + NADH + H+ | S-(hydroxymethyl)glutathione dehydrogenase |
Table of KEGG human pathways containing S-Formylglutathione
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01100 | Metabolic pathways | 2 |
hsa01200 | Carbon metabolism | 2 |