Metabolomics Structure Database
|
|
| MW REGNO: | 57326 |
| Common Name: | Bucladesine |
| Systematic Name: | 6-N-butanoyl-2'-O-butanoyladenosine 3',5'-(hydrogen phosphate) |
| Synonyms: | 3',5'-cyclic AMP dibutyrate; N(6),2'-O-dibutyryl cAMP; N(6),2'-O-dibutyryl cyclic AMP; N(6),O(2')-dibutyryl adenosine 3',5'-cyclic monophosphate; N(6),O(2')-dibutyryl cAMP; N(6),O(2')-dibutyryl cyclic 3',5'-AMP; N(6),O(2')-dibutyryl cyclic AMP; N(6),O(2')-dibutyryl-3',5'-cyclic AMP; N(6),O(2')-dibutyryladenosine 3',5'-monophosphate; dibutyryl 3',5'-cyclic AMP; dibutyryl adenosine 3',5'-cyclic phosphate; dibutyryl adenosine 3',5'-monophosphate; dibutyryl cAMP; dibutyryl cyclic 3',5'-adenylic acid; dibutyryl cyclic AMP; dibutyryl cyclic adenosine 3',5'-monophosphate; dibutyryl-3',5'-AMP; dibutyryladenosine 3',5'-cyclic monophosphate; dibutyryladenosine cyclic monophosphate [PubChem Synonyms] |
| Exact Mass: | |
| Formula: | C18H24N5O8P |
| InChIKey: | CJGYSWNGNKCJSB-YVLZZHOMSA-N |
| ClassyFire superclass: | Nucleosides, nucleotides, and analogues |
| ClassyFire class: | Purine nucleotides |
| ClassyFire subclass: | Cyclic purine nucleotides |
| ClassyFire direct parent: | 3',5'-cyclic purine nucleotides |
| SMILES: | CCCC(=O)Nc1c2c(ncn1)n(cn2)[C@H]1[C@@H]([C@H]2[C@@H](COP(=O)(O)O2)O1)OC(=O)CCC |
| Studies: | Available studies(via PubChem CID) |
Select appropriate tab below to view additional details:
External database links:
| PubChem CID: | 9687 |
| CHEBI ID: | 50095 |
| EPA CompTox DB: | DTXCID00209637 |
Calculated physicochemical properties (?):
| Heavy Atoms: | 32 |
| Rings: | 4 |
| Aromatic Rings: | 2 |
| Rotatable Bonds: | 8 |
| van der Waals Molecular volume: | 378.03 Å3 molecule-1 |
| Toplogical Polar Sufrace Area: | 170.20 Å2 molecule-1 |
| Hydrogen Bond Donors: | 2 |
| Hydrogen Bond Acceptors: | 12 |
| logP: | 3.00 |
| Molar Refractivity: | 110.10 |
| Fraction sp3 Carbons: | 0.61 |
| sp3 Carbons: | 11 |
References
LIPID MAPS classification: "Update of the LIPID MAPS comprehensive classification system for lipids", Fahy E, Subramaniam S, Murphy RC, Nishijima M, Raetz CR, Shimizu T, Spener F, van Meer G, Wakelam MJ, and Dennis EA, J. Lipid Res. (2009) 50: S9-S14. DOI: 10.1194/jlr.R800095-JLR200 ClassyFire classification: "ClassyFire: automated chemical classification with a comprehensive, computable taxonomy", Djoumbou Feunang Y, Eisner R, Knox C, Chepelev L, Hastings J, Owen G, Fahy E, Steinbeck C, Subramanian S, Bolton E, Greiner R, and Wishart DS, J. Cheminformatics (2016) 8:61. DOI: 10.1186/s13321-016-0174-y NPClassifier classification: "NPClassifier: A Deep Neural Network-Based Structural Classification Tool for Natural Products", Kim HW, Wang M, Leber CA, Nothias LF, Reher R, Kang KB, van der Hooft JJJ, Dorrestein PC, Gerwick WH and Cottrell GW. J Nat Prod. 2021 Nov 26;84(11):2795-2807.DOI: 10.1021/acs.jnatprod.1c00399.