RefMet Compound Details
MW structure | 34488 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | (20R,22R)-20,22-Dihydroxycholesterol | |
Systematic name | cholest-5-en-3beta,20R,22R-triol | |
SMILES | CC(C)CC[C@H]([C@@](C)([C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 27:1;O3 | View other entries in RefMet with this sum composition |
Exact mass | 418.344695 (neutral) |
Table of KEGG reactions in human pathways involving (20R,22R)-20,22-Dihydroxycholesterol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04854 | 20alpha-Hydroxycholesterol + Oxygen + 2 Reduced adrenal ferredoxin + 2 H+ <=> 20alpha,22beta-Dihydroxycholesterol + H2O + 2 Oxidized adrenal ferredoxin | 20alpha-Hydroxycholesterol:oxygen oxidoreductase (side-chain-cleaving) |
R04855 | 22(R)-Hydroxycholesterol + Oxygen + 2 Reduced adrenal ferredoxin + 2 H+ <=> 20alpha,22beta-Dihydroxycholesterol + H2O + 2 Oxidized adrenal ferredoxin | 22beta-Hydroxycholesterol:oxygen oxidoreductase (side-chain-cleaving) |
R03933 | 20alpha,22beta-Dihydroxycholesterol + Oxygen + 2 Reduced adrenal ferredoxin + 2 H+ <=> 4-Methylpentanal + Pregnenolone + 2 H2O + 2 Oxidized adrenal ferredoxin | 20alpha,22beta-Dihydroxycholesterol,ferredoxin:oxygen oxidoreductase (side-chain-cleaving) |
Table of KEGG human pathways containing (20R,22R)-20,22-Dihydroxycholesterol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 3 |