RefMet Compound Details
MW structure | 71675 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 1-Methylhistidine | |
Systematic name | (2S)-2-ammonio-3-(1-methylimidazol-4-yl)propionate | |
SMILES | Cn1cc(C[C@@H](C(=O)O)N)nc1 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 169.085127 (neutral) |
Table of KEGG reactions in human pathways involving 1-Methylhistidine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03286 | ATP + N(pi)-Methyl-L-histidine + beta-Alanine <=> ADP + Orthophosphate + beta-Alanyl-N(pi)-methyl-L-histidine | N(pi)-methyl-L-histidine:beta-alanine ligase (ADP-forming) |
Table of KEGG human pathways containing 1-Methylhistidine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00410 | beta-Alanine metabolism | 2 |
hsa00340 | Histidine metabolism | 1 |