RefMet Compound Details
MW structure | 35470 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 11-Dehydrocorticosterone | |
SMILES | C[C@]12CCC(=O)C=C1CC[C@H]1[C@@H]3CCC(C(=O)CO)[C@@]3(C)CC(=O)[C@H]21 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 21:4;O4 | View other entries in RefMet with this sum composition |
Exact mass | 344.198760 (neutral) |
Table of KEGG reactions in human pathways involving 11-Dehydrocorticosterone
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03847 | Corticosterone + NAD+ <=> 11-Dehydrocorticosterone + NADH + H+ | Corticosterone:NAD+ 11-oxidoreductase |
R03848 | Corticosterone + NADP+ <=> 11-Dehydrocorticosterone + NADPH + H+ | Corticosterone:NADP+ 11-oxidoreductase |
Table of KEGG human pathways containing 11-Dehydrocorticosterone
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 2 |