RefMet Compound Details
MW structure | 35467 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 11beta,21-Dihydroxy-5beta-pregnane-3,20-dione | |
Systematic name | 11b,21-Dihydroxy-5b-pregnane-3,20-dione | |
SMILES | C[C@]12CCC(=O)C[C@H]1CC[C@H]1[C@@H]3CCC(C(=O)CO)[C@@]3(C)C[C@@H]([C@H]21)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 21:2;O4 | View other entries in RefMet with this sum composition |
Exact mass | 348.230060 (neutral) |
Table of KEGG reactions in human pathways involving 11beta,21-Dihydroxy-5beta-pregnane-3,20-dione
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04837 | Tetrahydrocorticosterone + NAD+ <=> 11beta,21-Dihydroxy-5beta-pregnane-3,20-dione + NADH + H+ | Tetrahydrocorticosterone:NAD+ oxidoreductase (B-specific) |
R04838 | Tetrahydrocorticosterone + NADP+ <=> 11beta,21-Dihydroxy-5beta-pregnane-3,20-dione + NADPH + H+ | Tetrahydrocorticosterone:NADP+ oxidoreductase (B-specific) |
Table of KEGG human pathways containing 11beta,21-Dihydroxy-5beta-pregnane-3,20-dione
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 2 |