RefMet Compound Details
MW structure | 2397 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 13,14-Dihydro-15-keto-PGE2 | |
Systematic name | 9,15-dioxo-11R-hydroxy-5Z-prostenoic acid | |
SMILES | CCCCCC(=O)CC[C@@H]1[C@@H](C/C=C\CCCC(=O)O)C(=O)C[C@H]1O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 352.224975 (neutral) |
Table of KEGG reactions in human pathways involving 13,14-Dihydro-15-keto-PGE2
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04556 | (5Z)-11alpha-Hydroxy-9,15-dioxoprostanoate + NAD+ <=> (5Z,13E)-11alpha-Hydroxy-9,15-dioxoprost-5,13-dienoate + NADH + H+ | (5Z)-(15S)-11alpha-hydroxy-9,15-dioxoprostanoate:NAD+ delta13-oxidoreductase |
R04557 | (5Z)-11alpha-Hydroxy-9,15-dioxoprostanoate + NADP+ <=> (5Z,13E)-11alpha-Hydroxy-9,15-dioxoprost-5,13-dienoate + NADPH + H+ | (5Z)-(15S)-11alpha-hydroxy-9,15-dioxoprostanoate:NADP+ delta13-oxidoreductase |
Table of KEGG human pathways containing 13,14-Dihydro-15-keto-PGE2
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00590 | Arachidonic acid metabolism | 2 |