RefMet Compound Details
MW structure | 34466 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 14-Demethyllanosterol | |
Systematic name | 4,4-dimethyl-5alpha-cholesta-8,24-dien-3beta-ol | |
SMILES | CC(=CCC[C@@H](C)[C@H]1CC[C@H]2C3=C(CC[C@]12C)[C@@]1(C)CC[C@@H](C(C)(C)[C@@H]1CC3)O)C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 29:2;O | View other entries in RefMet with this sum composition |
Exact mass | 412.370515 (neutral) |
Table of KEGG reactions in human pathways involving 14-Demethyllanosterol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R05639 | 14-Demethyllanosterol + NADP+ <=> 4,4-Dimethyl-5alpha-cholesta-8,14,24-trien-3beta-ol + NADPH + H+ | 4,4-dimethyl-5a-cholesta-8,24-dien-3b-ol:NADP+ D14-oxidoreductase |
R07499 | 14-Demethyllanosterol + NADPH + H+ <=> 4,4-Dimethyl-5alpha-cholesta-8-en-3beta-ol + NADP+ | 14-Demethyllanosterol + NADPH + H+ <=> 4,4-Dimethyl-5alpha-cholesta-8-en-3beta-ol + NADP+ |
R07509 | 14-Demethyllanosterol + 6 Ferrocytochrome b5 + 3 Oxygen + 6 H+ <=> 4alpha-Methylzymosterol-4-carboxylate + 6 Ferricytochrome b5 + 4 H2O | 14-demethyllanosterol,ferrocytochrome-b5:oxygen oxidoreductase (hydroxylating) |
Table of KEGG human pathways containing 14-Demethyllanosterol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00100 | Steroid biosynthesis | 3 |