RefMet Compound Details
MW structure | 37747 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 2-Methyl-3-hydroxybutyryl-CoA | |
Alternative name | CoA 4:0;2Me,3OH | |
Systematic name | {[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-2-({[hydroxy({hydroxy[3-hydroxy-3-({2-[(2-{[(2S,3S)-3-hydroxy-2-methylbutanoyl]sulfanyl}ethyl)carbamoyl]ethyl}carbamoyl)-2,2-dimethylpropoxy]phosphoryl}oxy)phosphoryl]oxy}methyl)oxolan-3-yl]oxy}phosphonic acid | |
SMILES | C[C@@H]([C@H](C)O)C(=O)SCCNC(=O)CCNC(=O)C(C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 5:0;O | View other entries in RefMet with this sum composition |
Exact mass | 867.167649 (neutral) |
Table of KEGG reactions in human pathways involving 2-Methyl-3-hydroxybutyryl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04204 | (2S,3S)-3-Hydroxy-2-methylbutanoyl-CoA <=> 2-Methylbut-2-enoyl-CoA + H2O | (2S,3S)-3-Hydroxy-2-methylbutanoyl-CoA hydro-liase |
R04203 | (2S,3S)-3-Hydroxy-2-methylbutanoyl-CoA + NAD+ <=> 2-Methylacetoacetyl-CoA + NADH + H+ | (2S,3S)-3-hydroxy-2-methylbutanoyl-CoA:NAD+ oxidoreductase |
Table of KEGG human pathways containing 2-Methyl-3-hydroxybutyryl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00280 | Valine, leucine and isoleucine degradation | 2 |