RefMet Compound Details
MW structure | 2576 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 20-Hydroxy LTB4 | |
Systematic name | 5S,12R,20-trihydroxy-6Z,8E,10E,14Z-eicosatetraenoic acid | |
SMILES | C(CCCCO)/C=C\C[C@H](/C=C/C=C/C=C\[C@H](CCCC(=O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 352.224975 (neutral) |
Table of KEGG reactions in human pathways involving 20-Hydroxy LTB4
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03866 | Leukotriene B4 + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> 20-OH-Leukotriene B4 + [Oxidized NADPH---hemoprotein reductase] + H2O | (6Z,8E,10E,14Z)-(5S,12R)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate,[reduced NADPH---hemoprotein reductase]:oxygen oxidoreductase (20-hydroxylating) |
Table of KEGG human pathways containing 20-Hydroxy LTB4
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00590 | Arachidonic acid metabolism | 1 |