RefMet Compound Details
MW structure | 35473 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 21-Deoxycortisol | |
Systematic name | 11beta,17alpha-dihydroxypregn-4-ene-3,20-dione | |
SMILES | CC(=O)[C@]1(CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@H](C[C@]12C)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 21:3;O4 | View other entries in RefMet with this sum composition |
Exact mass | 346.214410 (neutral) |
Table of KEGG reactions in human pathways involving 21-Deoxycortisol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03329 | 17alpha-Hydroxyprogesterone + 2 Reduced ferredoxin + Oxygen + 2 H+ <=> 21-Deoxycortisol + 2 Oxidized ferredoxin + H2O | steroid,reduced-adrenal-ferredoxin:oxygen oxidoreductase (11-hydroxylating) |
R04852 | 21-Deoxycortisol + [Oxidized NADPH---hemoprotein reductase] + H2O <=> 11beta-Hydroxyprogesterone + [Reduced NADPH---hemoprotein reductase] + Oxygen | 11beta-hydroxyprogesterone,NADPH-hemoprotein reductase:oxygen oxidoreductase (17alpha-hydroxylating) |
R02838 | 21-Deoxycortisol + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> Cortisol + [Oxidized NADPH---hemoprotein reductase] + H2O | 21-deoxycortisol,NADPH-hemoprotein reductase:oxygen oxidoreductase (21-hydroxylating) |
Table of KEGG human pathways containing 21-Deoxycortisol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 3 |