RefMet Compound Details
MW structure | 35446 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 21-Hydroxypregnenolone | |
Systematic name | 3beta,21-dihydroxypregn-5-en-20-one | |
SMILES | C[C@]12CC[C@@H](CC1=CC[C@H]1[C@@H]3CC[C@H](C(=O)CO)[C@@]3(C)CC[C@H]21)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 21:2;O3 | View other entries in RefMet with this sum composition |
Exact mass | 332.235145 (neutral) |
Table of KEGG reactions in human pathways involving 21-Hydroxypregnenolone
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04163 | 21-Hydroxypregnenolone + NAD+ <=> 11-Deoxycorticosterone + NADH + H+ | 21-Hydroxypregnenolone:NAD+ 3-oxidoreductase |
R03784 | Pregnenolone + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> 21-Hydroxypregnenolone + [Oxidized NADPH---hemoprotein reductase] + H2O | pregnenolone,NADPH-hemoprotein reductase:oxygen oxidoreductase (21-hydroxylating) |
Table of KEGG human pathways containing 21-Hydroxypregnenolone
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 2 |