RefMet Compound Details
MW structure | 34393 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 22R-Hydroxycholesterol | |
Systematic name | cholest-5-en-3beta,22R-diol | |
SMILES | CC(C)CC[C@H]([C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 27:1;O2 | View other entries in RefMet with this sum composition |
Exact mass | 402.349780 (neutral) |
Table of KEGG reactions in human pathways involving 22R-Hydroxycholesterol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04855 | 22(R)-Hydroxycholesterol + Oxygen + 2 Reduced adrenal ferredoxin + 2 H+ <=> 20alpha,22beta-Dihydroxycholesterol + H2O + 2 Oxidized adrenal ferredoxin | 22beta-Hydroxycholesterol:oxygen oxidoreductase (side-chain-cleaving) |
R02723 | Cholesterol + Oxygen + 2 Reduced adrenal ferredoxin + 2 H+ <=> 22(R)-Hydroxycholesterol + H2O + 2 Oxidized adrenal ferredoxin | Cholesterol + Oxygen + 2 Reduced adrenal ferredoxin + 2 H+ <=> 22(R)-Hydroxycholesterol + H2O + 2 Oxidized adrenal ferredoxin |
Table of KEGG human pathways containing 22R-Hydroxycholesterol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 2 |