RefMet Compound Details
MW structure | 38491 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 5-L-Glutamyl-taurine | |
Systematic name | (2S)-2-amino-4-[(2-sulfoethyl)carbamoyl]butanoic acid | |
SMILES | C(CC(=O)NCCS(=O)(=O)O)[C@@H](C(=O)O)N Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 254.057257 (neutral) |
Table of KEGG reactions in human pathways involving 5-L-Glutamyl-taurine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01687 | (5-L-Glutamyl)-peptide + Taurine <=> Peptide + 5-L-Glutamyl-taurine | (5-L-glutamyl)-peptide:taurine 5-glutamyltransferase |
Table of KEGG human pathways containing 5-L-Glutamyl-taurine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00430 | Taurine and hypotaurine metabolism | 1 |