RefMet Compound Details
MW structure | 1520 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 5-Phosphomevalonic acid | |
Systematic name | 3R-methyl-3-hydroxypentanoic acid 5-phosphate | |
SMILES | C[C@@](CCOP(=O)(O)O)(CC(=O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 228.039893 (neutral) |
Table of KEGG reactions in human pathways involving 5-Phosphomevalonic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02245 | ATP + (R)-Mevalonate <=> ADP + (R)-5-Phosphomevalonate | ATP:(R)-mevalonate 5-phosphotransferase |
R03245 | ATP + (R)-5-Phosphomevalonate <=> ADP + (R)-5-Diphosphomevalonate | ATP:(R)-5-phosphomevalonate phosphotransferase |
Table of KEGG human pathways containing 5-Phosphomevalonic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00900 | Terpenoid backbone biosynthesis | 2 |