RefMet Compound Details
MW structure | 35477 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 5beta-Pregnane-3alpha,21-diol-11,20-dione | |
Systematic name | (3R)-3-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-one | |
SMILES | C[C@]12CC[C@H](C[C@H]1CC[C@H]1[C@@H]3CCC(C(=O)CO)[C@@]3(C)CC(=O)[C@H]21)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 21:2;O4 | View other entries in RefMet with this sum composition |
Exact mass | 348.230060 (neutral) |
Table of KEGG reactions in human pathways involving 5beta-Pregnane-3alpha,21-diol-11,20-dione
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04842 | 3alpha,21-Dihydroxy-5beta-pregnane-11,20-dione + NAD+ <=> 21-Hydroxy-5beta-pregnane-3,11,20-trione + NADH + H+ | 3alpha,21-Dihydroxy-5beta-pregnane-11,20-dione:NAD+ oxidoreductase (B-specific) |
R04843 | 3alpha,21-Dihydroxy-5beta-pregnane-11,20-dione + NADP+ <=> 21-Hydroxy-5beta-pregnane-3,11,20-trione + NADPH + H+ | 3alpha,21-Dihydroxy-5beta-pregnane-11,20-dione:NADP+ oxidoreductase (B-specific) |
R04840 | Tetrahydrocorticosterone + NADP+ <=> 3alpha,21-Dihydroxy-5beta-pregnane-11,20-dione + NADPH + H+ | Tetrahydrocorticosterone:NADP+ 11-oxidoreductase |
Table of KEGG human pathways containing 5beta-Pregnane-3alpha,21-diol-11,20-dione
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 3 |