RefMet Compound Details
MW structure | 38459 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 6-Hydroxymelatonin | |
Systematic name | N-[2-(6-hydroxy-5-methoxy-1H-indol-3-yl)ethyl]acetamide | |
SMILES | CC(=O)NCCc1c[nH]c2cc(c(cc12)OC)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 248.116092 (neutral) |
Table of KEGG reactions in human pathways involving 6-Hydroxymelatonin
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03629 | Melatonin + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> 6-Hydroxymelatonin + [Oxidized NADPH---hemoprotein reductase] + H2O | melatonin,NADPH---hemoprotein reductase:oxygen oxidoreductase |
Table of KEGG human pathways containing 6-Hydroxymelatonin
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00380 | Tryptophan metabolism | 1 |