RefMet Compound Details
MW structure | 29040 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 9-cis-Retinal | |
Systematic name | (2E,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexenyl)nona-2,4,6,8-tetraenal | |
SMILES | C/C(=C/C=C/C(=C/C=O)/C)/C=C/C1=C(C)CCCC1(C)C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 284.214015 (neutral) |
Table of KEGG reactions in human pathways involving 9-cis-Retinal
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R08385 | 9-cis-Retinal + NAD+ + H2O <=> 9-cis-Retinoic acid + NADH + H+ | retinal:NAD+ oxidoreductase |
R08382 | 9-cis-Retinol + NAD+ <=> 9-cis-Retinal + NADH + H+ | 9-cis-retinol:NAD+ oxidoreductase |
R08384 | 9-cis-Retinal + Oxygen + H2O <=> 9-cis-Retinoic acid + Hydrogen peroxide | retinal:oxygen oxidoreductase |
R08383 | 9-cis-Retinol + NADP+ <=> 9-cis-Retinal + NADPH + H+ | 9-cis-Retinol + NADP+ <=> 9-cis-Retinal + NADPH + H+ |
Table of KEGG human pathways containing 9-cis-Retinal
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00830 | Retinol metabolism | 4 |
hsa01100 | Metabolic pathways | 1 |