RefMet Compound Details

MW structure37043 (View MW Metabolite Database details)
RefMet nameAMP
Systematic name{[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}phosphonic acid
SMILESC([C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)O)OP(=O)(O)O   Run Tanimoto similarity search (with similarity coefficient >=0.6)
Exact mass347.063088 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC10H14N5O7PView other entries in RefMet with this formula
InChIInChI=1S/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,1
8,19,20)/t4-,6-,7-,10-/m1/s1
InChIKeyUDMBCSSLTHHNCD-KQYNXXCUSA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassNucleic acids
Main ClassPurines
Sub ClassPurine rNMP
Pubchem CID6083
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving AMP

Rxn IDKEGG ReactionEnzyme
R00182 AMP + H2O <=> Adenine + D-Ribose 5-phosphateAMP phosphoribohydrolase
R00333 Nucleoside triphosphate + AMP <=> NDP + ADPnucleoside-triphosphate:AMP phosphotransferase
R00190 AMP + Diphosphate <=> Adenine + 5-Phospho-alpha-D-ribose 1-diphosphateAMP:diphosphate phospho-D-ribosyltransferase
R00122 ADP + H2O <=> AMP + OrthophosphateADP phosphohydrolase
R00087 ATP + H2O <=> AMP + DiphosphateATP diphosphohydrolase (diphosphate-forming)
R00185 ATP + Adenosine <=> ADP + AMPATP:adenosine 5'-phosphotransferase
R00191 3',5'-Cyclic AMP + H2O <=> AMPadenosine 3',5'-phosphate 5'-nucleotidohydrolase
R00181 AMP + H2O <=> IMP + AmmoniaAMP aminohydrolase
R10836 AMP + Orthophosphate <=> Adenine + D-Ribose 1,5-bisphosphateAMP:phosphate (5-phospho-alpha-D-ribosyl)transferase
R00127 ATP + AMP <=> 2 ADPATP:AMP phosphotransferase
R00183 AMP + H2O <=> Adenosine + Orthophosphateadenosine 5'-monophosphate phosphohydrolase
R01083 N6-(1,2-Dicarboxyethyl)-AMP <=> Fumarate + AMPN6-(1,2-dicarboxyethyl)AMP AMP-lyase (fumarate-forming)

Table of KEGG human pathways containing AMP

Pathway IDHuman Pathway# of reactions
hsa00230 Purine metabolism 10
hsa01100 Metabolic pathways 2
hsa00250 Alanine, aspartate and glutamate metabolism 1
  logo