RefMet Compound Details
MW structure | 69926 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Adenylsuccinic acid | |
Alternative name | Aspartyl adenylate | |
Systematic name | (2S)-2-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)tetrahydrofuran-2-yl]purin-6-yl]amino]butanedioic acid | |
SMILES | C([C@@H](C(=O)O)Nc1c2c(ncn1)n(cn2)[C@H]1[C@@H]([C@@H]([C@@H](COP(=O)(O)O)O1)O)O)C(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 463.074043 (neutral) |
Table of KEGG reactions in human pathways involving Adenylsuccinic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01083 | N6-(1,2-Dicarboxyethyl)-AMP <=> Fumarate + AMP | N6-(1,2-dicarboxyethyl)AMP AMP-lyase (fumarate-forming) |
R01135 | GTP + IMP + L-Aspartate <=> GDP + Orthophosphate + N6-(1,2-Dicarboxyethyl)-AMP | IMP:L-aspartate ligase (GDP-forming) |
Table of KEGG human pathways containing Adenylsuccinic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00230 | Purine metabolism | 2 |
hsa00250 | Alanine, aspartate and glutamate metabolism | 2 |