RefMet Compound Details
MW structure | 29031 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | All-trans-3,4-didehydro retinol | |
Systematic name | 3,4-didehydro-retinol | |
SMILES | C/C(=C\C=C\C(=C\CO)\C)/C=C/C1=C(C)C=CCC1(C)C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 284.214015 (neutral) |
Table of KEGG reactions in human pathways involving All-trans-3,4-didehydro retinol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R11952 | Retinol + 2 Reduced adrenal ferredoxin + 2 H+ + Oxygen <=> all-trans-3,4-Didehydroretinol + 2 Oxidized adrenal ferredoxin + 2 H2O | all-trans-retinol,reduced adrenodoxin:oxygen 3,4-oxidoreductase |
Table of KEGG human pathways containing All-trans-3,4-didehydro retinol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00830 | Retinol metabolism | 1 |