RefMet Compound Details
MW structure | 42833 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Altretamine | |
Systematic name | 2-N,2-N,4-N,4-N,6-N,6-N-hexamethyl-1,3,5-triazine-2,4,6-triamine | |
SMILES | CN(C)c1nc(nc(n1)N(C)C)N(C)C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 210.159294 (neutral) |
Table of KEGG reactions in human pathways involving Altretamine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00310 | Protoporphyrin + Fe2+ <=> Heme + 2 H+ | protoheme ferro-lyase (protoporphyrin-forming) |
R11579 | Heme + 6 Reduced ferredoxin + 3 Oxygen + 6 H+ <=> Biliverdin + Fe2+ + CO + 6 Oxidized ferredoxin + 3 H2O | protoheme,reduced ferredoxin:oxygen oxidoreductase (alpha-methene-oxidizing, hydroxylating) |
R02480 | Cytochrome c <=> Apocytochrome c + Heme | Cytochrome c apocytochrome-c-lyase |
R00311 | Heme + 3 [Reduced NADPH---hemoprotein reductase] + 3 Oxygen <=> Biliverdin + CO + Fe2+ + 3 [Oxidized NADPH---hemoprotein reductase] + 3 H2O | protoheme,NADPH---hemoprotein reductase:oxygen oxidoreductase (alpha-methene-oxidizing, hydroxylating) |
R07411 | Heme + H2O + trans,trans-Farnesyl diphosphate <=> Heme O + Diphosphate | (2E,6E)-farnesyl-diphosphate:protoheme IX farnesyltranstransferase |
Table of KEGG human pathways containing Altretamine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00860 | Porphyrin and chlorophyll metabolism | 4 |
hsa01100 | Metabolic pathways | 1 |