RefMet Compound Details

RefMet ID, RefMet name, exact mass and formula
RefMet IDRM0135963
RefMet nameArginine
Systematic name(2S)-2-amino-5-[(diaminomethylidene)amino]pentanoic acid
SynonymsPubChem Synonyms
Exact mass174.111676 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC6H14N4O2View other entries in RefMet with this formula
Molecular descriptors
Molfile37289 (Download molfile/View MW Metabolite Database details)
InChIInChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t4-/m0/s1
InChIKeyODKSFYDXXFIFQN-BYPYZUCNSA-NView other enantiomers/diastereomers of this metabolite in RefMet
SMILESC(C[C@@H](C(=O)O)N)CNC(=N)N
Run Tanimoto similarity search (with similarity coefficient >=0.6)
Chemical/Biochemical Classification
Super ClassOrganic acids
Main ClassAmino acids and peptides
Sub ClassAmino acids
Distribution of Arginine in NMDR studies
SpeciesPlot Species distribution
Sample sourcePlot Sample source(tissue) distribution
PlatformPlatform (MS/NMR) used for detection
ChromatographyChromatography methods used for detection
StudiesNMDR Studies reporting Arginine
External Links
Pubchem CID6322
ChEBI ID29016
KEGG IDC00062
HMDB IDHMDB0000517
Chemspider ID6082
MetaCyc IDARG
EPA CompToxDTXCID902618
Spectral data for Arginine standards
BMRB ID(NMR)View NMR spectra
NP-MRD ID(NMR)View NMR spectra
MassBank(EU)View MS spectra
Structural annotation level
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Arginine

Rxn IDKEGG ReactionEnzyme
R00551 L-Arginine + H2O <=> L-Ornithine + UreaL-Arginine amidinohydrolase
R00552 L-Arginine + H2O <=> L-Citrulline + AmmoniaL-Arginine iminohydrolase
R00557 2 L-Arginine + 4 Oxygen + 3 NADPH + 3 H+ <=> 2 Nitric oxide + 2 L-Citrulline + 3 NADP+ + 4 H2OL-arginine,NADPH:oxygen oxidoreductase (nitric-oxide-forming)
R00558 L-Arginine + Oxygen + NADPH + H+ <=> N(omega)-Hydroxyarginine + NADP+ + H2OL-arginine,NADPH:oxygen oxidoreductase (N-(omega)-hydroxyarginine-forming)
R00565 L-Arginine + Glycine <=> L-Ornithine + GuanidinoacetateL-Arginine:glycine amidinotransferase
R00566 L-Arginine <=> Agmatine + CO2L-arginine carboxy-lyase (agmatine-forming)
R01086 N-(L-Arginino)succinate <=> Fumarate + L-Arginine2-(Nomega-L-arginino)succinate arginine-lyase (fumarate-forming)
R03646 ATP + L-Arginine + tRNA(Arg) <=> AMP + Diphosphate + L-Arginyl-tRNA(Arg)L-Arginine:tRNA(Arg) ligase (AMP-forming)
R11033 L-Arginine <=> N(omega)-HydroxyarginineL-Arginine <=> N(omega)-Hydroxyarginine
R11711 2 L-Arginine + 3 Reduced flavodoxin + 4 Oxygen <=> 2 L-Citrulline + 2 Nitric oxide + 3 Oxidized flavodoxin + 4 H2OL-arginine,reduced-flavodoxin:oxygen oxidoreductase (nitric-oxide-forming)
R11712 2 L-Arginine + 2 Reduced flavodoxin + 2 Oxygen <=> 2 N(omega)-Hydroxyarginine + 2 Oxidized flavodoxin + 2 H2O2 L-Arginine + 2 Reduced flavodoxin + 2 Oxygen <=> 2 N(omega)-Hydroxyarginine + 2 Oxidized flavodoxin + 2 H2O

Table of KEGG human pathways containing Arginine

Pathway IDHuman Pathway# of reactions
hsa00330 Arginine and proline metabolism 4
hsa01100 Metabolic pathways 4
hsa00220 Arginine biosynthesis 3
hsa01230 Biosynthesis of amino acids 2
hsa00260 Glycine, serine and threonine metabolism 1
hsa00970 Aminoacyl-tRNA biosynthesis 1
hsa00250 Alanine, aspartate and glutamate metabolism 1
  logo