RefMet Compound Details

MW structure37126 (View MW Metabolite Database details)
RefMet nameAspartic acid
Systematic name(2S)-2-aminobutanedioic acid
Canonical SMILESN[C@@H](CC(O)=O)C(O)=O
Exact mass133.0375View other entries in RefMet with this exact mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC4H7NO4View other entries in RefMet with this formula
InChIInChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1
InChIKeyCKLJMWTZIZZHCS-REOHCLBHSA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassOrganic acids
Main ClassAmino acids and peptides
Sub ClassAmino acids
Pubchem CID5960

Table of KEGG reactions in human pathways involving Aspartic acid

Rxn IDKEGG ReactionEnzyme
R00485 L-Asparagine + H2O <=> L-Aspartate + AmmoniaL-asparagine amidohydrolase
R00578 ATP + L-Aspartate + L-Glutamine + H2O <=> AMP + Diphosphate + L-Asparagine + L-GlutamateL-aspartate:L-glutamine amido-ligase (AMP-forming)
R00481 L-Aspartate + Oxygen <=> Iminoaspartate + Hydrogen peroxideL-aspartate:oxygen oxidoreductase
R00487 Acetyl-CoA + L-Aspartate <=> CoA + N-Acetyl-L-aspartateacetyl-CoA:L-aspartate N-acetyltransferase
R00357 L-Aspartate + H2O + Oxygen <=> Oxaloacetate + Ammonia + Hydrogen peroxideL-Aspartic acid:oxygen oxidoreductase (deaminating)
R00483 ATP + L-Aspartate + Ammonia <=> AMP + Diphosphate + L-AsparagineL-aspartate:ammonia ligase (AMP-forming)
R00355 L-Aspartate + 2-Oxoglutarate <=> Oxaloacetate + L-GlutamateL-Aspartate:2-oxoglutarate aminotransferase
R00488 N-Acetyl-L-aspartate + H2O <=> Acetate + L-AspartateN-Acetyl-L-aspartate amidohydrolase
R07407 L-Aspartate + NADP+ <=> Iminoaspartate + NADPH + H+L-aspartate:NADP+ oxidoreductase (deaminating)
R00526 N-Formyl-L-aspartate + H2O <=> Formate + L-AspartateN-Formyl-L-aspartate amidohydrolase
R07410 L-Aspartate + NAD+ <=> Iminoaspartate + NADH + H+L-aspartate:NAD+ oxidoreductase (deaminating)
R00489 L-Aspartate <=> beta-Alanine + CO2L-aspartate 1-carboxy-lyase (beta-alanine-forming)

Table of KEGG human pathways containing Aspartic acid

Pathway IDHuman Pathway# of reactions
hsa00250 Alanine, aspartate and glutamate metabolism 7
hsa00220 Arginine biosynthesis 2
hsa01230 Biosynthesis of amino acids 2
hsa00410 beta-Alanine metabolism 1
hsa00770 Pantothenate and CoA biosynthesis 1
hsa01200 Carbon metabolism 1
hsa01210 2-Oxocarboxylic acid metabolism 1
hsa00340 Histidine metabolism 1
  logo