RefMet Compound Details

MW structure50741 (View MW Metabolite Database details)
RefMet nameBiliverdin
Systematic namebiliverdin
Canonical SMILESCC1=C(C=C)C(=O)NC1=CC1=N/C(=C\c2[nH]c(/C=C3\NC(=O)C(C)=C\3C=C)c(C)c2CCC(O)=O)/C(CCC(O)=O)=C1C
Exact mass582.2478View other entries in RefMet with this exact mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC33H34N4O6View other entries in RefMet with this formula
InChIInChI=1S/C33H34N4O6/c1-7-20-19(6)32(42)37-27(20)14-25-18(5)23(10-12-31(40)41)29(35-25)15-28-22(9-11-30(38)39)17(4)24(34-28)13-26-16(3)21(8-2)33(43)36-26/h7-8,13-15,35H,1-2,9-12H2,3-6H3,(H,36,43)(H,37,42)(H,38,39)(H,40,41)/b26-13-,27-14-,28-15-
InChIKeyQBUVFDKTZJNUPP-BBROENKCSA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassOrganoheterocyclic compounds
Main ClassBilirubins
Sub ClassBilirubins
Pubchem CID5280353

Table of KEGG reactions in human pathways involving Biliverdin

Rxn IDKEGG ReactionEnzyme
R11579 Heme + 6 Reduced ferredoxin + 3 Oxygen + 6 H+ <=> Biliverdin + Fe2+ + CO + 6 Oxidized ferredoxin + 3 H2Oprotoheme,reduced ferredoxin:oxygen oxidoreductase (alpha-methene-oxidizing, hydroxylating)
R02393 Bilirubin + NADP+ <=> Biliverdin + NADPH + H+Bilirubin:NADP+ oxidoreductase
R12481 Bilirubin + Oxidised coenzyme F420-(gamma-Glu)n <=> Biliverdin + Reduced coenzyme F420-(gamma-Glu)nBilirubin + Oxidised coenzyme F420-(gamma-Glu)n <=> Biliverdin + Reduced coenzyme F420-(gamma-Glu)n
R02391 Bilirubin + NAD+ <=> Biliverdin + NADH + H+Bilirubin:NAD+ oxidoreductase
R00311 Heme + 3 [Reduced NADPH---hemoprotein reductase] + 3 Oxygen <=> Biliverdin + CO + Fe2+ + 3 [Oxidized NADPH---hemoprotein reductase] + 3 H2Oprotoheme,NADPH---hemoprotein reductase:oxygen oxidoreductase (alpha-methene-oxidizing, hydroxylating)

Table of KEGG human pathways containing Biliverdin

Pathway IDHuman Pathway# of reactions
hsa00860 Porphyrin and chlorophyll metabolism 1
  logo