RefMet Compound Details
MW structure | 50741 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Biliverdin | |
Systematic name | biliverdin | |
SMILES | C=CC1=C(C)C(=O)N/C/1=C\c1c(C)c(CCC(=O)O)c(/C=C\2/C(=C(C)C(=N2)/C=C\2/C(=C(C=C)C(=O)N2)C)CCC(=O)O)[nH]1 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 582.247836 (neutral) |
Table of KEGG reactions in human pathways involving Biliverdin
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R11579 | Heme + 6 Reduced ferredoxin + 3 Oxygen + 6 H+ <=> Biliverdin + Fe2+ + CO + 6 Oxidized ferredoxin + 3 H2O | protoheme,reduced ferredoxin:oxygen oxidoreductase (alpha-methene-oxidizing, hydroxylating) |
R02393 | Bilirubin + NADP+ <=> Biliverdin + NADPH + H+ | Bilirubin:NADP+ oxidoreductase |
R12481 | Bilirubin + Oxidised coenzyme F420-(gamma-Glu)n <=> Biliverdin + Reduced coenzyme F420-(gamma-Glu)n | Bilirubin + Oxidised coenzyme F420-(gamma-Glu)n <=> Biliverdin + Reduced coenzyme F420-(gamma-Glu)n |
R02391 | Bilirubin + NAD+ <=> Biliverdin + NADH + H+ | Bilirubin:NAD+ oxidoreductase |
R00311 | Heme + 3 [Reduced NADPH---hemoprotein reductase] + 3 Oxygen <=> Biliverdin + CO + Fe2+ + 3 [Oxidized NADPH---hemoprotein reductase] + 3 H2O | protoheme,NADPH---hemoprotein reductase:oxygen oxidoreductase (alpha-methene-oxidizing, hydroxylating) |
Table of KEGG human pathways containing Biliverdin
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01100 | Metabolic pathways | 4 |
hsa00860 | Porphyrin metabolism | 2 |
hsa00860 | Porphyrin and chlorophyll metabolism | 1 |