RefMet Compound Details
MW structure | 37886 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Caffeine | |
Systematic name | 1,3,7-trimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione | |
SMILES | Cn1cnc2c1c(=O)n(C)c(=O)n2C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 194.080376 (neutral) |
Table of KEGG reactions in human pathways involving Caffeine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07939 | Caffeine + NADPH + Oxygen + H+ <=> 1,7-Dimethylxanthine + NADP+ + Formaldehyde + H2O | caffeine:oxygen oxidoreductase (N3-demethylating) |
R07954 | Caffeine + NADH + H+ + Oxygen <=> 1,7-Dimethylxanthine + NAD+ + Formaldehyde + H2O | caffeine:oxygen oxidoreductase (N3-demethylating) |
Table of KEGG human pathways containing Caffeine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00232 | Caffeine metabolism | 1 |
hsa01100 | Metabolic pathways | 1 |