RefMet Compound Details
MW structure | 36274 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Chenodeoxycholic acid | |
Systematic name | 3alpha,7alpha-Dihydroxy-5beta-cholan-24-oic acid | |
SMILES | C[C@H](CCC(=O)O)[C@H]1CC[C@H]2[C@H]3[C@H](CC[C@]12C)[C@@]1(C)CC[C@H](C[C@H]1C[C@H]3O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 24:1;O4 | View other entries in RefMet with this sum composition |
Exact mass | 392.292660 (neutral) |
Table of KEGG reactions in human pathways involving Chenodeoxycholic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03974 | Chenodeoxycholate + CoA <=> Chenodeoxycholoyl-CoA + H2O | chenodeoxycholoyl-CoA hydrolase |
R08743 | Chenodeoxycholoyl-CoA + AMP + Diphosphate <=> Chenodeoxycholate + CoA + ATP | chenodeoxycholate:CoA ligase (AMP-forming) |
Table of KEGG human pathways containing Chenodeoxycholic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00120 | Primary bile acid biosynthesis | 2 |