RefMet Compound Details
MW structure | 35465 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Corticosterone | |
Systematic name | 11beta,21-dihydroxypregn-4-ene-3,20-dione | |
SMILES | C[C@]12CCC(=O)C=C1CC[C@H]1[C@@H]3CC[C@H](C(=O)CO)[C@@]3(C)C[C@@H]([C@H]21)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 21:3;O4 | View other entries in RefMet with this sum composition |
Exact mass | 346.214410 (neutral) |
Table of KEGG reactions in human pathways involving Corticosterone
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03847 | Corticosterone + NAD+ <=> 11-Dehydrocorticosterone + NADH + H+ | Corticosterone:NAD+ 11-oxidoreductase |
R03849 | 11beta-Hydroxyprogesterone + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> Corticosterone + [Oxidized NADPH---hemoprotein reductase] + H2O | 11beta-hydroxyprogesterone,NADPH-hemoprotein reductase:oxygen oxidoreductase (21-hydroxylating) |
R03851 | 11-Deoxycorticosterone + 2 Reduced ferredoxin + Oxygen + 2 H+ <=> Corticosterone + 2 Oxidized ferredoxin + H2O | 11-deoxycorticosterone,reduced ferredoxin:oxygen oxidoreductase (11-hydroxylating) |
R03848 | Corticosterone + NADP+ <=> 11-Dehydrocorticosterone + NADPH + H+ | Corticosterone:NADP+ 11-oxidoreductase |
R03262 | Corticosterone + 2 Reduced adrenal ferredoxin + Oxygen + 2 H+ <=> 18-Hydroxycorticosterone + 2 Oxidized adrenal ferredoxin + H2O | Corticosterone,reduced-adrenal-ferredoxin:oxygen oxidoreductase (18-hydroxylating) |
Table of KEGG human pathways containing Corticosterone
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 5 |