RefMet Compound Details
MW structure | 35388 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Cortisol | |
Systematic name | 11beta,17,21-trihydroxypregn-4-ene-3,20-dione | |
SMILES | C[C@]12CCC(=O)C=C1CC[C@H]1[C@@H]3CC[C@](C(=O)CO)([C@@]3(C)C[C@@H]([C@H]21)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 21:3;O5 | View other entries in RefMet with this sum composition |
Exact mass | 362.209325 (neutral) |
Table of KEGG reactions in human pathways involving Cortisol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02834 | Cortisol + NAD+ <=> Cortisone + NADH + H+ | Cortisol:NAD+ 11-oxidoreductase |
R02840 | Cortisol + H+ + NADH <=> 11beta,17alpha,21-Trihydroxypregnenolone + NAD+ | Cortisol delta5-delat4-isomerase |
R02838 | 21-Deoxycortisol + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> Cortisol + [Oxidized NADPH---hemoprotein reductase] + H2O | 21-deoxycortisol,NADPH-hemoprotein reductase:oxygen oxidoreductase (21-hydroxylating) |
R02841 | 11beta,17alpha,21-Trihydroxy-5beta-pregnane-3,20-dione + NADP+ <=> Cortisol + NADPH + H+ | 11beta,17alpha,21-Trihydroxy-5beta-pregnane-3,20-dione:NADP+ delta4-oxidoreductase |
R02836 | Cortisol + NADP+ <=> Cortisone + NADPH + H+ | Cortisol:NADP+ 11-oxidoreductase |
R02843 | 11-Deoxycortisol + 2 Reduced ferredoxin + Oxygen + 2 H+ <=> Cortisol + 2 Oxidized ferredoxin + H2O | steroid,reduced ferredoxin:oxygen oxidoreductase (11-hydroxylating) |
Table of KEGG human pathways containing Cortisol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 6 |