RefMet Compound Details
MW structure | 35394 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Cortisone | |
Systematic name | 17alpha,21-dihydroxypregn-4-ene-3,11,20-trione | |
SMILES | C[C@]12CCC(=O)C=C1CC[C@H]1[C@@H]3CC[C@](C(=O)CO)([C@@]3(C)CC(=O)[C@H]21)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 21:4;O5 | View other entries in RefMet with this sum composition |
Exact mass | 360.193675 (neutral) |
Table of KEGG reactions in human pathways involving Cortisone
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02836 | Cortisol + NADP+ <=> Cortisone + NADPH + H+ | Cortisol:NADP+ 11-oxidoreductase |
R02834 | Cortisol + NAD+ <=> Cortisone + NADH + H+ | Cortisol:NAD+ 11-oxidoreductase |
R02893 | 17alpha,21-Dihydroxy-5beta-pregnane-3,11,20-trione + NADP+ <=> Cortisone + NADPH + H+ | 17alpha,21-dihydroxy-5beta-pregnane-3,11,20-trione:NADP+ delta4-oxidoreductase |
Table of KEGG human pathways containing Cortisone
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 3 |