RefMet Compound Details
MW structure | 610 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | DHA | |
Alternative name | FA 22:6(4Z,7Z,10Z,13Z,16Z,19Z) | |
Systematic name | 4Z,7Z,10Z,13Z,16Z,19Z-docosahexaenoic acid | |
SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | FA 22:6 | View other entries in RefMet with this sum composition |
Exact mass | 328.240230 (neutral) |
Table of KEGG reactions in human pathways involving DHA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R08180 | (4Z,7Z,10Z,13Z,16Z,19Z)-Docosahexaenoyl-CoA + H2O <=> CoA + (4Z,7Z,10Z,13Z,16Z,19Z)-Docosahexaenoic acid | (4Z,7Z,10Z,13Z,16Z,19Z)-Docosahexaenoyl-CoA + H2O <=> CoA + (4Z,7Z,10Z,13Z,16Z,19Z)-Docosahexaenoic acid |
Table of KEGG human pathways containing DHA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01040 | Biosynthesis of unsaturated fatty acids | 1 |