RefMet Compound Details
MW structure | 46324 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Daidzin | |
Systematic name | 3-(4-hydroxyphenyl)-7-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-4H-chromen-4-one | |
SMILES | c1cc(ccc1c1coc2cc(ccc2c1=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 416.110735 (neutral) |
Table of KEGG reactions in human pathways involving Daidzin
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07720 | Daidzein + UDP-glucose <=> Daidzin + UDP | UDP-glucose:isoflavone 7-O-beta-D-glucosyltransferase |
R13051 | Daidzin + H2O <=> Daidzein + beta-D-Glucose | daidzein 7-O-glucoside glucohydrolase |
Table of KEGG human pathways containing Daidzin
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01100 | Metabolic pathways | 2 |