RefMet Compound Details
MW structure | 49954 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Deoxyribose | |
Systematic name | (4S,5R)-5-(hydroxymethyl)oxolane-2,4-diol | |
SMILES | C1[C@@H]([C@@H](CO)OC1O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 134.057910 (neutral) |
Table of KEGG reactions in human pathways involving Deoxyribose
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02750 | 2-Deoxy-D-ribose 5-phosphate + ADP <=> Deoxyribose + ATP | ATP:2-deoxy-D-ribose 5-phosphotransferase |
Table of KEGG human pathways containing Deoxyribose
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00030 | Pentose phosphate pathway | 1 |