RefMet Compound Details
MW structure | 34376 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Desmosterol | |
Systematic name | cholest-5,24-dien-3beta-ol | |
SMILES | CC(=CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)O)C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 27:2;O | View other entries in RefMet with this sum composition |
Exact mass | 384.339215 (neutral) |
Table of KEGG reactions in human pathways involving Desmosterol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01457 | Cholesterol + NADP+ <=> Desmosterol + H+ + NADPH | cholesterol:NADP+ Delta24-oxidoreductase |
Table of KEGG human pathways containing Desmosterol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00100 | Steroid biosynthesis | 1 |