RefMet Compound Details
MW structure | 37628 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Diadenosine triphosphate | |
Systematic name | {[(2S,3R,4S,5S)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}({[({[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy](hydroxy)phosphoryl}oxy)phosphinic acid | |
SMILES | C([C@H]1[C@@H]([C@@H]([C@@H](n2cnc3c(N)ncnc23)O1)O)O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 756.081934 (neutral) |
Table of KEGG reactions in human pathways involving Diadenosine triphosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00187 | P1,P3-Bis(5'-adenosyl) triphosphate + H2O <=> ADP + AMP | P1,P3-bis(5'-adenosyl)-triphosphate adenylohydrolase |
Table of KEGG human pathways containing Diadenosine triphosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00230 | Purine metabolism | 1 |