RefMet Compound Details
MW structure | 1099 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | EPA | |
Alternative name | FA 20:5(5Z,8Z,11Z,14Z,17Z) | |
Systematic name | 5Z,8Z,11Z,14Z,17Z-eicosapentaenoic acid | |
SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | FA 20:5 | View other entries in RefMet with this sum composition |
Exact mass | 302.224580 (neutral) |
Table of KEGG reactions in human pathways involving EPA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R08179 | (5Z,8Z,11Z,14Z,17Z)-Icosapentaenoyl-CoA + H2O <=> CoA + (5Z,8Z,11Z,14Z,17Z)-Icosapentaenoic acid | (5Z,8Z,11Z,14Z,17Z)-icosapentaenoyl-CoA hydrolase |
Table of KEGG human pathways containing EPA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01040 | Biosynthesis of unsaturated fatty acids | 1 |