RefMet Compound Details
MW structure | 28197 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Farnesyl diphosphate | |
Systematic name | Farnesyl pyrophosphate | |
SMILES | CC(=CCC/C(=C/CC/C(=C/COP(=O)(O)OP(=O)(O)O)/C)/C)C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 382.131031 (neutral) |
Table of KEGG reactions in human pathways involving Farnesyl diphosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02003 | Geranyl diphosphate + Isopentenyl diphosphate <=> Diphosphate + trans,trans-Farnesyl diphosphate | Geranyl-diphosphate:isopentenyl-diphosphate geranyltrans-transferase |
R00702 | 2 trans,trans-Farnesyl diphosphate <=> Diphosphate + Presqualene diphosphate | farnesyl-diphosphate:farnesyl-diphosphate farnesyltransferase |
R06223 | 2 trans,trans-Farnesyl diphosphate + NADPH + H+ <=> Squalene + 2 Diphosphate + NADP+ | squalene synthase |
R09844 | trans,trans-Farnesyl diphosphate + Protein-cysteine <=> S-Farnesyl protein + Diphosphate | farnesyl-diphosphate:protein-cysteine farnesyltransferase |
R05556 | trans,trans-Farnesyl diphosphate + n Isopentenyl diphosphate <=> Dehydrodolichol diphosphate + n Diphosphate | (2E,6E)-farnesyl-diphosphate:isopentenyl-diphosphate cistransferase (adding 10-55 isopentenyl units) |
R09249 | trans,trans-Farnesyl diphosphate + 7 Isopentenyl diphosphate <=> all-trans-Decaprenyl diphosphate + 7 Diphosphate | (2E,6E)-farnesyl-diphosphate:isopentenyl-diphosphate farnesyltranstransferase (adding 7 isopentenyl units) |
Table of KEGG human pathways containing Farnesyl diphosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00900 | Terpenoid backbone biosynthesis | 5 |
hsa00100 | Steroid biosynthesis | 1 |
hsa01100 | Metabolic pathways | 1 |