RefMet Compound Details
MW structure | 37083 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Folic acid | |
Systematic name | (2S)-2-[(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}phenyl)formamido]pentanedioic acid | |
SMILES | c1cc(ccc1C(=O)N[C@@H](CCC(=O)O)C(=O)O)NCc1cnc2c(c(=O)[nH]c(N)n2)n1 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 441.139683 (neutral) |
Table of KEGG reactions in human pathways involving Folic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00937 | Tetrahydrofolate + 2 NAD+ <=> Folate + 2 NADH + 2 H+ | 5,6,7,8-tetrahydrofolate:NAD+ oxidoreductase |
R00940 | Tetrahydrofolate + 2 NADP+ <=> Folate + 2 NADPH + 2 H+ | 5,6,7,8-tetrahydrofolate:NADP+ oxidoreductase |
R02236 | Dihydrofolate + NADP+ <=> Folate + NADPH + H+ | dihydrofolate:NADP+ oxidoreductase |
R02235 | Dihydrofolate + NAD+ <=> Folate + NADH + H+ | dihydrofolate:NAD+ oxidoreductase |
Table of KEGG human pathways containing Folic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00670 | One carbon pool by folate | 4 |
hsa00790 | Folate biosynthesis | 4 |
hsa01100 | Metabolic pathways | 4 |
hsa01240 | Biosynthesis of cofactors | 4 |