RefMet Compound Details
MW structure | 49823 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Fructose | |
Systematic name | (3S,4R,5R)-1,3,4,5,6-pentakis(oxidanyl)hexan-2-one | |
SMILES | C1[C@H]([C@H]([C@@H](C(CO)(O)O1)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 180.063390 (neutral) |
Table of KEGG reactions in human pathways involving Fructose
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03920 | ATP + beta-D-Fructose <=> ADP + beta-D-Fructose 6-phosphate | ATP:D-fructose 6-phosphotransferase |
R00760 | ATP + D-Fructose <=> ADP + D-Fructose 6-phosphate | ATP:D-fructose 6-phosphotransferase |
R00875 | D-Sorbitol + NAD+ <=> D-Fructose + NADH + H+ | D-Glucitol:NAD+ 2-oxidoreductase |
R00866 | ATP + D-Fructose <=> ADP + D-Fructose 1-phosphate | ATP:D-fructose 1-phosphotransferase |
R00867 | ATP + D-Fructose <=> ADP + beta-D-Fructose 6-phosphate | ATP:D-fructose 6-phosphotransferase |
R03232 | Protein N(pi)-phospho-L-histidine + D-Fructose <=> Protein histidine + D-Fructose 1-phosphate | protein-N(pi)-phosphohistidine:D-fructose 1-phosphotransferase |
Table of KEGG human pathways containing Fructose
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00051 | Fructose and mannose metabolism | 3 |
hsa00500 | Starch and sucrose metabolism | 2 |
hsa00052 | Galactose metabolism | 1 |
hsa00520 | Amino sugar and nucleotide sugar metabolism | 1 |
hsa01100 | Metabolic pathways | 1 |