RefMet Compound Details
MW structure | 37568 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Fructose 2,6-bisphosphate | |
Systematic name | {[(2R,3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)-5-(phosphonooxy)oxolan-2-yl]methoxy}phosphonic acid | |
SMILES | C([C@@H]1[C@H]([C@@H]([C@@](CO)(O1)OP(=O)(O)O)O)O)OP(=O)(O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 339.996056 (neutral) |
Table of KEGG reactions in human pathways involving Fructose 2,6-bisphosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02731 | beta-D-Fructose 2,6-bisphosphate + H2O <=> beta-D-Fructose 6-phosphate + Orthophosphate | D-Fructose-2,6-bisphosphate 2-phosphohydrolase |
R02732 | ATP + beta-D-Fructose 6-phosphate <=> ADP + beta-D-Fructose 2,6-bisphosphate | ATP:D-fructose-6-phosphate 2-phosphotransferase |
Table of KEGG human pathways containing Fructose 2,6-bisphosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00051 | Fructose and mannose metabolism | 1 |
hsa01100 | Metabolic pathways | 1 |