RefMet Compound Details
MW structure | 37077 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Galactitol | |
Systematic name | (2R,3S,4R,5S)-hexane-1,2,3,4,5,6-hexol | |
SMILES | C([C@@H]([C@H]([C@H]([C@@H](CO)O)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 182.079040 (neutral) |
Table of KEGG reactions in human pathways involving Galactitol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01093 | D-Galactose + NADH + H+ <=> Galactitol + NAD+ | galactitol:NAD+ 1-oxidoreductase |
R01095 | D-Galactose + NADPH + H+ <=> Galactitol + NADP+ | galactitol:NADP+ 1-oxidoreductase |
Table of KEGG human pathways containing Galactitol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00052 | Galactose metabolism | 2 |
hsa01100 | Metabolic pathways | 2 |