RefMet Compound Details
MW structure | 2024 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Glucaric acid | |
Systematic name | 2S,3S,4S,5R-tetrahydroxy-hexanedioic acid | |
SMILES | O=C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | FA 6:1;O6 | View other entries in RefMet with this sum composition |
Exact mass | 210.037570 (neutral) |
Table of KEGG reactions in human pathways involving Glucaric acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02957 | D-Glucuronolactone + NAD+ + 2 H2O <=> D-Glucarate + NADH + H+ | D-Glucuronolactone:NAD+ oxidoreductase |
Table of KEGG human pathways containing Glucaric acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00053 | Ascorbate and aldarate metabolism | 1 |