RefMet Compound Details
MW structure | 37084 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Glucose | |
Systematic name | (3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol | |
SMILES | OC[C@@H]1OC(O)[C@@H](O)[C@H](O)[C@H]1O | |
Sum Composition | Glucose | View other entries in RefMet with this sum composition |
Exact mass | 180.063390 (neutral) |
Table of KEGG reactions in human pathways involving Glucose
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01787 | D-Sorbitol + NADP+ <=> alpha-D-Glucose + NADPH + H+ | D-Glucitol:NADP+ 1-oxidoreductase |
R01790 | Starch + H2O <=> D-Glucose + Starch | 1,4-alpha-D-Glucan glucohydrolase |
R01788 | alpha-D-Glucose 6-phosphate + H2O <=> alpha-D-Glucose + Orthophosphate | alpha-D-Glucose 6-phosphate phosphohydrolase |
R02189 | Polyphosphate + alpha-D-Glucose <=> Polyphosphate + alpha-D-Glucose 6-phosphate | Polyphosphate:D-glucose 6-phosphotransferase |
R02738 | Protein N(pi)-phospho-L-histidine + D-Glucose <=> Protein histidine + alpha-D-Glucose 6-phosphate | protein-N(pi)-phosphohistidine:D-glucose 6-phosphotransferase |
R09085 | alpha-D-Glucose + ADP <=> alpha-D-Glucose 6-phosphate + AMP | ADP:D-glucose 6-phosphotransferase |
R01791 | Dextrin + H2O <=> D-Glucose + Dextrin | Dextrin 6-alpha-D-glucanohydrolase |
R01602 | alpha-D-Glucose <=> beta-D-Glucose | D-glucose 1-epimerase |
R01786 | ATP + alpha-D-Glucose <=> ADP + alpha-D-Glucose 6-phosphate | ATP:alpha-D-glucose 6-phosphotransferase |
Table of KEGG human pathways containing Glucose
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00010 | Glycolysis / Gluconeogenesis | 4 |
hsa00052 | Galactose metabolism | 3 |
hsa00500 | Starch and sucrose metabolism | 2 |
hsa00051 | Fructose and mannose metabolism | 1 |
hsa00520 | Amino sugar and nucleotide sugar metabolism | 1 |