RefMet Compound Details
MW structure | 38350 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Glucose 1,6-bisphosphate | |
Systematic name | {[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(phosphonooxy)methyl]oxan-2-yl]oxy}phosphonic acid | |
SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)OP(=O)(O)O)O)O)O)OP(=O)(O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 339.996056 (neutral) |
Table of KEGG reactions in human pathways involving Glucose 1,6-bisphosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00949 | ATP + D-Glucose 1-phosphate <=> ADP + alpha-D-Glucose 1,6-bisphosphate | ATP:D-glucose-1-phosphate 6-phosphotransferase |
R01660 | 3-Phospho-D-glyceroyl phosphate + D-Glucose 1-phosphate <=> 3-Phospho-D-glycerate + alpha-D-Glucose 1,6-bisphosphate | 3-phospho-D-glyceroyl-phosphate:alpha-D-glucose-1-phosphate 6-phosphotransferase |
Table of KEGG human pathways containing Glucose 1,6-bisphosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00500 | Starch and sucrose metabolism | 1 |
hsa01100 | Metabolic pathways | 1 |