RefMet Compound Details

RefMet ID, RefMet name, exact mass and formula
RefMet IDRM0135889
RefMet nameGlutathione
Systematic name(2S)-2-amino-4-{[(1R)-1-[(carboxymethyl)carbamoyl]-2-sulfanylethyl]carbamoyl}butanoic acid
SynonymsPubChem Synonyms
Exact mass307.083809 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC10H17N3O6SView other entries in RefMet with this formula
Molecular descriptors
Molfile37087 (Download molfile/View MW Metabolite Database details)
InChIInChI=1S/C10H17N3O6S/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/t5
-,6-/m0/s1
InChIKeyRWSXRVCMGQZWBV-WDSKDSINSA-NView other enantiomers/diastereomers of this metabolite in RefMet
SMILESC(CC(=O)N[C@@H](CS)C(=O)NCC(=O)O)[C@@H](C(=O)O)N
Run Tanimoto similarity search (with similarity coefficient >=0.6)
Chemical/Biochemical Classification
Super ClassOrganic acids
Main ClassAmino acids and peptides
Sub ClassTripeptides
Distribution of Glutathione in NMDR studies
SpeciesPlot Species distribution
Sample sourcePlot Sample source(tissue) distribution
PlatformPlatform (MS/NMR) used for detection
ChromatographyChromatography methods used for detection
StudiesNMDR Studies reporting Glutathione
External Links
Pubchem CID124886
ChEBI ID16856
KEGG IDC00051
HMDB IDHMDB0000125
Chemspider ID111188
MetaCyc IDGLUTATHIONE
EPA CompToxDTXCID50209263
Spectral data for Glutathione standards
BMRB ID(NMR)View NMR spectra
NP-MRD ID(NMR)View NMR spectra
MassBank(EU)View MS spectra
Structural annotation level
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Glutathione

Rxn IDKEGG ReactionEnzyme
R00115 2 Glutathione + NADP+ <=> Glutathione disulfide + NADPH + H+glutathione:NADP+ oxidoreductase
R00120 Oxygen + 2 Glutathione <=> Glutathione disulfide + Hydrogen peroxideglutathione:oxygen oxidoreductase
R00274 Hydrogen peroxide + 2 Glutathione <=> Glutathione disulfide + 2 H2Oglutathione:hydrogen-peroxide oxidoreductase
R00494 Glutathione + H2O <=> Cys-Gly + L-Glutamateglutathione gamma-glutamylaminopeptidase
R00497 ATP + gamma-L-Glutamyl-L-cysteine + Glycine <=> ADP + Orthophosphate + Glutathionegamma-L-glutamyl-L-cysteine:glycine ligase (ADP-forming)
R01108 Dehydroascorbate + 2 Glutathione <=> Glutathione disulfide + Ascorbateglutathione:dehydroascorbate oxidoreductase
R01109 Cystine + 2 Glutathione <=> Glutathione disulfide + 2 CysteineGlutathione:cystine oxidoreductase
R01110 Homocystine + 2 Glutathione <=> Glutathione disulfide + 2 Homocysteineglutathione:homocystine oxidoreductase
R01111 CoA + Glutathione disulfide <=> CoA-glutathione + Glutathionecoenzyme A:glutathione-disulfide oxidoreductase
R01262 Glutathione + L-Amino acid <=> Cys-Gly + (5-L-Glutamyl)-L-amino acidglutathione:L-amino-acid 5-glutamyltransferase
R01875 Thiosulfate + 2 Glutathione + H+ <=> Sulfite + Glutathione disulfide + Hydrogen sulfideThiosulfate:thiol sulfurtransferase
R02824 Insulin + 2 Glutathione <=> Reduced insulin + Glutathione disulfideglutathione:insulin oxidoreductase
R03167 Lipid hydroperoxide + 2 Glutathione <=> Lipid + Glutathione disulfide + 2 H2Oglutathione:lipid-hydroperoxide oxidoreductase
R03522 RX + Glutathione <=> Halide + R-S-GlutathioneRX:glutathione R-transferase
R03915 Protein dithiol + Glutathione disulfide <=> Protein disulfide + 2 Glutathioneglutathione:protein-disulfide oxidoreductase
R03984 Pyrimidodiazepine + Glutathione disulfide + H2O <=> 6-Pyruvoyltetrahydropterin + 2 Glutathionepyrimidodiazepine:glutathione-disulfide oxidoreductase (ring-opening, cyclizing)
R04039 [Xanthine dehydrogenase] + Glutathione disulfide <=> [Xanthine oxidase] + 2 Glutathione[xanthine-dehydrogenase]:glutathione-disulfide S-oxidoreductase
R11861 Glutathione <=> Cys-Gly + 5-Oxoprolineglutathione gamma-glutamyl cyclotransferase (5-oxoproline-forming)
R12578 2 Glutathione + ROOH <=> Glutathione disulfide + H2O + ROHglutathione:hydroperoxide oxidoreductase

Table of KEGG human pathways containing Glutathione

Pathway IDHuman Pathway# of reactions
hsa00480 Glutathione metabolism 11
hsa01100 Metabolic pathways 11
  logo