RefMet Compound Details
MW structure | 37093 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Guanine | |
Systematic name | 2-amino-6,7-dihydro-3H-purin-6-one | |
SMILES | c1nc2c([nH]1)nc(N)[nH]c2=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 151.049410 (neutral) |
Table of KEGG reactions in human pathways involving Guanine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01676 | Guanine + H2O <=> Xanthine + Ammonia | Guanine aminohydrolase |
R02147 | Guanosine + Orthophosphate <=> Guanine + alpha-D-Ribose 1-phosphate | guanosine:phosphate alpha-D-ribosyltransferase |
R01229 | GMP + Diphosphate <=> Guanine + 5-Phospho-alpha-D-ribose 1-diphosphate | GMP:diphosphate 5-phospho-alpha-D-ribosyltransferase |
R01677 | Guanosine + H2O <=> Guanine + D-Ribose | Guanosine ribohydrolase |
R01969 | Deoxyguanosine + Orthophosphate <=> Guanine + 2-Deoxy-D-ribose 1-phosphate | Deoxyguanosine:orthophosphate ribosyltransferase |
Table of KEGG human pathways containing Guanine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00230 | Purine metabolism | 4 |
hsa01100 | Metabolic pathways | 1 |