RefMet Compound Details
MW structure | 2773 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Hepoxilin B3 | |
Systematic name | 10-hydroxy-11S,12S-epoxy-5Z,8Z,14Z-eicosatrienoic acid | |
SMILES | CCCCC/C=C\C[C@H]1[C@H](C(/C=C\C/C=C\CCCC(=O)O)O)O1 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 336.230060 (neutral) |
Table of KEGG reactions in human pathways involving Hepoxilin B3
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07040 | 12(S)-HPETE <=> Hepoxilin B3 | 12(S)-HPETE hydroxymutase |
Table of KEGG human pathways containing Hepoxilin B3
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00590 | Arachidonic acid metabolism | 1 |
hsa01100 | Metabolic pathways | 1 |