RefMet Compound Details
MW structure | 49804 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Indolepyruvate | |
Systematic name | 3-(1H-indol-3-yl)-2-oxidanylidene-propanoic acid | |
SMILES | c1ccc2c(c1)c(CC(=O)C(=O)O)c[nH]2 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 203.058244 (neutral) |
Table of KEGG reactions in human pathways involving Indolepyruvate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00677 | L-Tryptophan + H2O + Oxygen <=> Indolepyruvate + Ammonia + Hydrogen peroxide | L-Tryptophan:oxygen oxidoreductase (deaminating) |
R12055 | L-Methionine + Indolepyruvate <=> 4-Methylthio-2-oxobutanoic acid + L-Tryptophan | L-methionine:indole-3-pyruvic acid aminotransferase |
R00684 | L-Tryptophan + 2-Oxoglutarate <=> Indolepyruvate + L-Glutamate | L-Tryptophan:2-oxoglutarate aminotransferase |
R10180 | L-Tryptophan + Pyruvate <=> Indolepyruvate + L-Alanine | L-tryptophan:pyruvate aminotransferase |
Table of KEGG human pathways containing Indolepyruvate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01100 | Metabolic pathways | 3 |
hsa00380 | Tryptophan metabolism | 1 |