RefMet Compound Details
MW structure | 39049 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Inositol 3-phosphate | |
Systematic name | {[(2S,3R,5S,6S)-2,3,4,5,6-pentahydroxycyclohexyl]oxy}phosphonic acid | |
SMILES | [C@@H]1([C@@H]([C@@H]([C@@H]([C@H]([C@@H]1O)O)OP(=O)(O)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 260.029723 (neutral) |
Table of KEGG reactions in human pathways involving Inositol 3-phosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01187 | 1D-myo-Inositol 3-phosphate + H2O <=> myo-Inositol + Orthophosphate | 1D-myo-inositol 3-phosphate phosphohydrolase |
R07279 | ATP + myo-Inositol <=> ADP + 1D-myo-Inositol 3-phosphate | ATP:1D-myo-inositol 3-phosphotransferase |
R07324 | D-Glucose 6-phosphate <=> 1D-myo-Inositol 3-phosphate | 1D-myo-inositol-3-phosphate lyase (isomerizing) |
R04372 | D-myo-Inositol 3,4-bisphosphate + H2O <=> 1D-myo-Inositol 3-phosphate + Orthophosphate | D-myo-Inositol-3,4-bisphosphate 4-phosphohydrolase |
Table of KEGG human pathways containing Inositol 3-phosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00562 | Inositol phosphate metabolism | 3 |
hsa04070 | Phosphatidylinositol signaling system | 2 |
hsa01100 | Metabolic pathways | 1 |